C15H27F6P — CID 12589476
tributyl-fluoro-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-lambda5-phosphane (PubChem CID 12589476) has the molecular formula C15H27F6P and a molecular weight of 352.34 g/mol. Its IUPAC name is tributyl-fluoro-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-lambda5-phosphane.
| Compound Name | tributyl-fluoro-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-lambda5-phosphane |
|---|---|
| PubChem CID | 12589476 |
| Molecular Formula | C15H27F6P |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tributyl-fluoro-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]-lambda5-phosphane |
| SMILES | CCCCP(F)(CCCC)(CCCC)/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C15H27F6P/c1-4-7-10-22(21,11-8-5-2,12-9-6-3)14(17)13(16)15(18,19)20/h4-12H2,1-3H3/b14-13- |
| InChIKey | ZDJLTLQTYPMOCQ-YPKPFQOOSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|