About tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride
tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride (PubChem CID 14950742) has the molecular formula C16H38F3P
and a molecular weight of 318.45 g/mol. Its IUPAC name is tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride.
Molecular Properties
| Compound Name | tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride |
| PubChem CID | 14950742 |
| Molecular Formula | C16H38F3P |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride |
| SMILES | CCCCP(F)(CCCC)(CCCC)CCCC.F.F |
| InChI | InChI=1S/C16H36FP.2FH/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H |
| InChIKey | VYPJQCWOJZVJEZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride?
The IUPAC name of tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride (CID 14950742) is tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride.
What is the SMILES notation for tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride?
The canonical SMILES for tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride is CCCCP(F)(CCCC)(CCCC)CCCC.F.F.
What is the InChIKey of tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride?
The InChIKey is VYPJQCWOJZVJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36FP.2FH/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H.
What are the key properties of tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride?
tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride has a molecular weight of 318.45 g/mol, XLogP of 6.93, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutyl(fluoro)-lambda5-phosphane;dihydrofluoride is sourced from PubChem (CID 14950742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).