About hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane
hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane (PubChem CID 160702804) has the molecular formula C16H41O2PSi
and a molecular weight of 324.56 g/mol. Its IUPAC name is hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane.
Molecular Properties
| Compound Name | hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane |
| PubChem CID | 160702804 |
| Molecular Formula | C16H41O2PSi |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane |
| SMILES | CCCCP(O)(CCCC)(CCCC)CCCC.O[SiH3] |
| InChI | InChI=1S/C16H37OP.H4OSi/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;1-2/h17H,5-16H2,1-4H3;1H,2H3 |
| InChIKey | RQVLRJGNRPFGBE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane?
The IUPAC name of hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane (CID 160702804) is hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane.
What is the SMILES notation for hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane?
The canonical SMILES for hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane is CCCCP(O)(CCCC)(CCCC)CCCC.O[SiH3].
What is the InChIKey of hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane?
The InChIKey is RQVLRJGNRPFGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H37OP.H4OSi/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;1-2/h17H,5-16H2,1-4H3;1H,2H3.
What are the key properties of hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane?
hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane has a molecular weight of 324.56 g/mol, XLogP of 3.91, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxysilane;tetrabutyl(hydroxy)-λ5-phosphane is sourced from PubChem (CID 160702804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).