About sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride
sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride (PubChem CID 173127559) has the molecular formula C8H22NaO3P
and a molecular weight of 220.22 g/mol. Its IUPAC name is sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride.
Molecular Properties
| Compound Name | sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride |
| PubChem CID | 173127559 |
| Molecular Formula | C8H22NaO3P |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride |
| SMILES | CCCCP(O)(O)(O)CCCC.[H-].[Na+] |
| InChI | InChI=1S/C8H21O3P.Na.H/c1-3-5-7-12(9,10,11)8-6-4-2;;/h9-11H,3-8H2,1-2H3;;/q;+1;-1 |
| InChIKey | MJWOOWKVKCDPKC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride?
The IUPAC name of sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride (CID 173127559) is sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride.
What is the SMILES notation for sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride?
The canonical SMILES for sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride is CCCCP(O)(O)(O)CCCC.[H-].[Na+].
What is the InChIKey of sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride?
The InChIKey is MJWOOWKVKCDPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21O3P.Na.H/c1-3-5-7-12(9,10,11)8-6-4-2;;/h9-11H,3-8H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride?
sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride has a molecular weight of 220.22 g/mol, XLogP of -1.02, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dibutyl(trihydroxy)-λ5-phosphane;hydride is sourced from PubChem (CID 173127559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).