About sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol
sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol (PubChem CID 173317934) has the molecular formula C4H14NaO5P
and a molecular weight of 196.11 g/mol. Its IUPAC name is sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol.
Molecular Properties
| Compound Name | sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol |
| PubChem CID | 173317934 |
| Molecular Formula | C4H14NaO5P |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol |
| SMILES | OCCP(O)(O)(O)CCO.[H-].[Na+] |
| InChI | InChI=1S/C4H13O5P.Na.H/c5-1-3-10(7,8,9)4-2-6;;/h5-9H,1-4H2;;/q;+1;-1 |
| InChIKey | NMTRWHARORBBDY-UHFFFAOYSA-N |
| XLogP | -4.64 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol?
The IUPAC name of sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol (CID 173317934) is sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol.
What is the SMILES notation for sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol?
The canonical SMILES for sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol is OCCP(O)(O)(O)CCO.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol?
The InChIKey is NMTRWHARORBBDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13O5P.Na.H/c5-1-3-10(7,8,9)4-2-6;;/h5-9H,1-4H2;;/q;+1;-1.
What are the key properties of sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol?
sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol has a molecular weight of 196.11 g/mol, XLogP of -4.64, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-[trihydroxy(2-hydroxyethyl)-λ5-phosphanyl]ethanol is sourced from PubChem (CID 173317934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).