About tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane
tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane (PubChem CID 173272787) has the molecular formula C32H72P2
and a molecular weight of 518.88 g/mol. Its IUPAC name is tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane.
Molecular Properties
| Compound Name | tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane |
| PubChem CID | 173272787 |
| Molecular Formula | C32H72P2 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.51 |
| IUPAC Name | tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)P(CCCC)(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C32H72P2/c1-9-17-25-33(26-18-10-2,27-19-11-3,28-20-12-4)34(29-21-13-5,30-22-14-6,31-23-15-7)32-24-16-8/h9-32H2,1-8H3 |
| InChIKey | QTRRNVQGIYOBCH-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane?
The IUPAC name of tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane (CID 173272787) is tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane.
What is the SMILES notation for tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane?
The canonical SMILES for tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane is CCCCP(CCCC)(CCCC)(CCCC)P(CCCC)(CCCC)(CCCC)CCCC.
What is the InChIKey of tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane?
The InChIKey is QTRRNVQGIYOBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H72P2/c1-9-17-25-33(26-18-10-2,27-19-11-3,28-20-12-4)34(29-21-13-5,30-22-14-6,31-23-15-7)32-24-16-8/h9-32H2,1-8H3.
What are the key properties of tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane?
tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane has a molecular weight of 518.88 g/mol, XLogP of 12.41, 25 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutyl-(tetrabutyl-λ5-phosphanyl)-λ5-phosphane is sourced from PubChem (CID 173272787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).