C20H36F9OP — CID 140712352
tetrabutyl-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-λ5-phosphane (PubChem CID 140712352) has the molecular formula C20H36F9OP and a molecular weight of 494.46 g/mol. Its IUPAC name is tetrabutyl-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-λ5-phosphane.
| Compound Name | tetrabutyl-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-λ5-phosphane |
|---|---|
| PubChem CID | 140712352 |
| Molecular Formula | C20H36F9OP |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | tetrabutyl-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-λ5-phosphane |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H36F9OP/c1-5-9-13-31(14-10-6-2,15-11-7-3,16-12-8-4)30-17(18(21,22)23,19(24,25)26)20(27,28)29/h5-16H2,1-4H3 |
| InChIKey | IAYVHRBBBWOPOZ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|