About [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate
[tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 87573486) has the molecular formula C21H44F3O3PS
and a molecular weight of 464.62 g/mol. Its IUPAC name is [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate |
| PubChem CID | 87573486 |
| Molecular Formula | C21H44F3O3PS |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | CCCCCCCCP(CCCC)(CCCC)(CCCC)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H44F3O3PS/c1-5-9-13-14-15-16-20-28(17-10-6-2,18-11-7-3,19-12-8-4)27-29(25,26)21(22,23)24/h5-20H2,1-4H3 |
| InChIKey | QVIKYDDPXUCBHC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate?
The IUPAC name of [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate (CID 87573486) is [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate.
What is the SMILES notation for [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate?
The canonical SMILES for [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate is CCCCCCCCP(CCCC)(CCCC)(CCCC)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate?
The InChIKey is QVIKYDDPXUCBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44F3O3PS/c1-5-9-13-14-15-16-20-28(17-10-6-2,18-11-7-3,19-12-8-4)27-29(25,26)21(22,23)24/h5-20H2,1-4H3.
What are the key properties of [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate?
[tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate has a molecular weight of 464.62 g/mol, XLogP of 8.08, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tributyl(octyl)-λ5-phosphanyl] trifluoromethanesulfonate is sourced from PubChem (CID 87573486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).