C24H51O2P — CID 170549709
[tributyl(hexyl)-λ5-phosphanyl] 2,2-dimethylbutanoate (PubChem CID 170549709) has the molecular formula C24H51O2P and a molecular weight of 402.64 g/mol. Its IUPAC name is [tributyl(hexyl)-λ5-phosphanyl] 2,2-dimethylbutanoate.
| Compound Name | [tributyl(hexyl)-λ5-phosphanyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 170549709 |
| Molecular Formula | C24H51O2P |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.36 |
| IUPAC Name | [tributyl(hexyl)-λ5-phosphanyl] 2,2-dimethylbutanoate |
| SMILES | CCCCCCP(CCCC)(CCCC)(CCCC)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C24H51O2P/c1-8-13-17-18-22-27(19-14-9-2,20-15-10-3,21-16-11-4)26-23(25)24(6,7)12-5/h8-22H2,1-7H3 |
| InChIKey | RTUZIFLSRNDCBG-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|