About [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate
[tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate (PubChem CID 141437338) has the molecular formula C54H98O6P2
and a molecular weight of 905.32 g/mol. Its IUPAC name is [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate.
Molecular Properties
| Compound Name | [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate |
| PubChem CID | 141437338 |
| Molecular Formula | C54H98O6P2 |
| Molecular Weight | 905.32 g/mol |
| Exact Mass | 904.68 |
| IUPAC Name | [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate |
| SMILES | CCCCCCCCP(CCCC)(CCCC)(CCCC)OC(=O)c1ccccc1O.CCCCCCCCP(CCCC)(CCCC)(CCCC)OC(=O)c1ccccc1O |
| InChI | InChI=1S/2C27H49O3P/c2*1-5-9-13-14-15-18-24-31(21-10-6-2,22-11-7-3,23-12-8-4)30-27(29)25-19-16-17-20-26(25)28/h2*16-17,19-20,28H,5-15,18,21-24H2,1-4H3 |
| InChIKey | RXTPYVCMHQHULV-UHFFFAOYSA-N |
| XLogP | 17.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 905.32 |
| LogP ≤ 5 | 17.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate?
The IUPAC name of [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate (CID 141437338) is [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate.
What is the SMILES notation for [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate?
The canonical SMILES for [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate is CCCCCCCCP(CCCC)(CCCC)(CCCC)OC(=O)c1ccccc1O.CCCCCCCCP(CCCC)(CCCC)(CCCC)OC(=O)c1ccccc1O.
What is the InChIKey of [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate?
The InChIKey is RXTPYVCMHQHULV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C27H49O3P/c2*1-5-9-13-14-15-18-24-31(21-10-6-2,22-11-7-3,23-12-8-4)30-27(29)25-19-16-17-20-26(25)28/h2*16-17,19-20,28H,5-15,18,21-24H2,1-4H3.
What are the key properties of [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate?
[tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate has a molecular weight of 905.32 g/mol, XLogP of 17.56, 36 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [tributyl(octyl)-λ5-phosphanyl] 2-hydroxybenzoate is sourced from PubChem (CID 141437338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).