About (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate
(tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate (PubChem CID 66763828) has the molecular formula C23H41O3P
and a molecular weight of 396.55 g/mol. Its IUPAC name is (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate |
| PubChem CID | 66763828 |
| Molecular Formula | C23H41O3P |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)OC(=O)c1ccccc1O |
| InChI | InChI=1S/C23H41O3P/c1-5-9-17-27(18-10-6-2,19-11-7-3,20-12-8-4)26-23(25)21-15-13-14-16-22(21)24/h13-16,24H,5-12,17-20H2,1-4H3 |
| InChIKey | MKFUAATYSIPMMN-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate?
The IUPAC name of (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate (CID 66763828) is (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate.
What is the SMILES notation for (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate?
The canonical SMILES for (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate is CCCCP(CCCC)(CCCC)(CCCC)OC(=O)c1ccccc1O.
What is the InChIKey of (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate?
The InChIKey is MKFUAATYSIPMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41O3P/c1-5-9-17-27(18-10-6-2,19-11-7-3,20-12-8-4)26-23(25)21-15-13-14-16-22(21)24/h13-16,24H,5-12,17-20H2,1-4H3.
What are the key properties of (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate?
(tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate has a molecular weight of 396.55 g/mol, XLogP of 7.22, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (tetrabutyl-λ5-phosphanyl) 2-hydroxybenzoate is sourced from PubChem (CID 66763828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).