About methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate
methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate (PubChem CID 155663719) has the molecular formula C21H47O5PS
and a molecular weight of 442.64 g/mol. Its IUPAC name is methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate.
Molecular Properties
| Compound Name | methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate |
| PubChem CID | 155663719 |
| Molecular Formula | C21H47O5PS |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate |
| SMILES | CCCCCCP(CCCCCC)(CCCCCC)(COC)OS(=O)(=O)OC |
| InChI | InChI=1S/C21H47O5PS/c1-6-9-12-15-18-27(21-24-4,19-16-13-10-7-2,20-17-14-11-8-3)26-28(22,23)25-5/h6-21H2,1-5H3 |
| InChIKey | QNTWGAZARURNOY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate?
The IUPAC name of methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate (CID 155663719) is methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate.
What is the SMILES notation for methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate?
The canonical SMILES for methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate is CCCCCCP(CCCCCC)(CCCCCC)(COC)OS(=O)(=O)OC.
What is the InChIKey of methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate?
The InChIKey is QNTWGAZARURNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H47O5PS/c1-6-9-12-15-18-27(21-24-4,19-16-13-10-7-2,20-17-14-11-8-3)26-28(22,23)25-5/h6-21H2,1-5H3.
What are the key properties of methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate?
methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate has a molecular weight of 442.64 g/mol, XLogP of 6.71, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [trihexyl(methoxymethyl)-λ5-phosphanyl] sulfate is sourced from PubChem (CID 155663719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).