C19H42F3O4PSSi — CID 134977303
[tributyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 134977303) has the molecular formula C19H42F3O4PSSi and a molecular weight of 482.66 g/mol. Its IUPAC name is [tributyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [tributyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134977303 |
| Molecular Formula | C19H42F3O4PSSi |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [tributyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | CCCCP(CCCC)(CCCC)(OS(=O)(=O)C(F)(F)F)C(CC)O[Si](C)(C)C |
| InChI | InChI=1S/C19H42F3O4PSSi/c1-8-12-15-27(16-13-9-2,17-14-10-3,18(11-4)25-29(5,6)7)26-28(23,24)19(20,21)22/h18H,8-17H2,1-7H3 |
| InChIKey | NJPYKKBBYGAOHI-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|