C18H33BF12O13S4Si2 — CID 10079373
tetrakis(trifluoromethylsulfonyloxy)boranuide;trimethyl(1-trimethylsilyloctan-4-yloxy)silane (PubChem CID 10079373) has the molecular formula C18H33BF12O13S4Si2 and a molecular weight of 880.68 g/mol. Its IUPAC name is tetrakis(trifluoromethylsulfonyloxy)boranuide;trimethyl(1-trimethylsilyloctan-4-yloxy)silane.
| Compound Name | tetrakis(trifluoromethylsulfonyloxy)boranuide;trimethyl(1-trimethylsilyloctan-4-yloxy)silane |
|---|---|
| PubChem CID | 10079373 |
| Molecular Formula | C18H33BF12O13S4Si2 |
| Molecular Weight | 880.68 g/mol |
| Exact Mass | 880.02 |
| IUPAC Name | tetrakis(trifluoromethylsulfonyloxy)boranuide;trimethyl(1-trimethylsilyloctan-4-yloxy)silane |
| SMILES | CCCCC(C[CH+]C[Si](C)(C)C)O[Si](C)(C)C.O=S(=O)(O[B-](OS(=O)(=O)C(F)(F)F)(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H33OSi2.C4BF12O12S4/c1-8-9-11-14(15-17(5,6)7)12-10-13-16(2,3)4;6-1(7,8)30(18,19)26-5(27-31(20,21)2(9,10)11,28-32(22,23)3(12,13)14)29-33(24,25)4(15,16)17/h10,14H,8-9,11-13H2,1-7H3;/q+1;-1 |
| InChIKey | AUSQNEHYAXBRHH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 182.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.68 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|