About nonan-5-yl hypofluorite
nonan-5-yl hypofluorite (PubChem CID 174958722) has the molecular formula C9H19FO
and a molecular weight of 162.25 g/mol. Its IUPAC name is nonan-5-yl hypofluorite.
Molecular Properties
| Compound Name | nonan-5-yl hypofluorite |
| PubChem CID | 174958722 |
| Molecular Formula | C9H19FO |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | nonan-5-yl hypofluorite |
| SMILES | CCCCC(CCCC)OF |
| InChI | InChI=1S/C9H19FO/c1-3-5-7-9(11-10)8-6-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | KEIVWMAMWKLXNP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze nonan-5-yl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-5-yl hypofluorite?
The IUPAC name of nonan-5-yl hypofluorite (CID 174958722) is nonan-5-yl hypofluorite.
What is the SMILES notation for nonan-5-yl hypofluorite?
The canonical SMILES for nonan-5-yl hypofluorite is CCCCC(CCCC)OF.
What is the InChIKey of nonan-5-yl hypofluorite?
The InChIKey is KEIVWMAMWKLXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19FO/c1-3-5-7-9(11-10)8-6-4-2/h9H,3-8H2,1-2H3.
What are the key properties of nonan-5-yl hypofluorite?
nonan-5-yl hypofluorite has a molecular weight of 162.25 g/mol, XLogP of 3.64, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-5-yl hypofluorite is sourced from PubChem (CID 174958722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).