About azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid
azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid (PubChem CID 174524240) has the molecular formula C14H34F3NO3PS+
and a molecular weight of 384.47 g/mol. Its IUPAC name is azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid |
| PubChem CID | 174524240 |
| Molecular Formula | C14H34F3NO3PS+ |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid |
| SMILES | CCCC[P+](C)(CCCC)CCCC.N.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H30P.CHF3O3S.H3N/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;2-1(3,4)8(5,6)7;/h5-13H2,1-4H3;(H,5,6,7);1H3/q+1;; |
| InChIKey | QUDJGAUOSMKCAC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid?
The IUPAC name of azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid (CID 174524240) is azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid.
What is the SMILES notation for azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid?
The canonical SMILES for azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid is CCCC[P+](C)(CCCC)CCCC.N.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid?
The InChIKey is QUDJGAUOSMKCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30P.CHF3O3S.H3N/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;2-1(3,4)8(5,6)7;/h5-13H2,1-4H3;(H,5,6,7);1H3/q+1;;.
What are the key properties of azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid?
azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid has a molecular weight of 384.47 g/mol, XLogP of 5.59, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tributyl(methyl)phosphanium;trifluoromethanesulfonic acid is sourced from PubChem (CID 174524240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).