About phosphoric acid;tributyl(methyl)phosphanium
phosphoric acid;tributyl(methyl)phosphanium (PubChem CID 166680840) has the molecular formula C13H33O4P2+
and a molecular weight of 315.35 g/mol. Its IUPAC name is phosphoric acid;tributyl(methyl)phosphanium.
Molecular Properties
| Compound Name | phosphoric acid;tributyl(methyl)phosphanium |
| PubChem CID | 166680840 |
| Molecular Formula | C13H33O4P2+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | phosphoric acid;tributyl(methyl)phosphanium |
| SMILES | CCCC[P+](C)(CCCC)CCCC.O=P(O)(O)O |
| InChI | InChI=1S/C13H30P.H3O4P/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-5(2,3)4/h5-13H2,1-4H3;(H3,1,2,3,4)/q+1; |
| InChIKey | URKHPCHRURHQST-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoric acid;tributyl(methyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoric acid;tributyl(methyl)phosphanium?
The IUPAC name of phosphoric acid;tributyl(methyl)phosphanium (CID 166680840) is phosphoric acid;tributyl(methyl)phosphanium.
What is the SMILES notation for phosphoric acid;tributyl(methyl)phosphanium?
The canonical SMILES for phosphoric acid;tributyl(methyl)phosphanium is CCCC[P+](C)(CCCC)CCCC.O=P(O)(O)O.
What is the InChIKey of phosphoric acid;tributyl(methyl)phosphanium?
The InChIKey is URKHPCHRURHQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30P.H3O4P/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-5(2,3)4/h5-13H2,1-4H3;(H3,1,2,3,4)/q+1;.
What are the key properties of phosphoric acid;tributyl(methyl)phosphanium?
phosphoric acid;tributyl(methyl)phosphanium has a molecular weight of 315.35 g/mol, XLogP of 4.11, 9 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;tributyl(methyl)phosphanium is sourced from PubChem (CID 166680840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).