About ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium
ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium (PubChem CID 90317907) has the molecular formula C22H50O2P2
and a molecular weight of 408.59 g/mol. Its IUPAC name is ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium.
Molecular Properties
| Compound Name | ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium |
| PubChem CID | 90317907 |
| Molecular Formula | C22H50O2P2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.33 |
| IUPAC Name | ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium |
| SMILES | CCCCCC[P+](C)(CCCCCC)CCCCCC.CCP(C)(=O)[O-] |
| InChI | InChI=1S/C19H42P.C3H9O2P/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;1-3-6(2,4)5/h5-19H2,1-4H3;3H2,1-2H3,(H,4,5)/q+1;/p-1 |
| InChIKey | QAKUMSSOUIDPLJ-UHFFFAOYSA-M |
| XLogP | 7.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium?
The IUPAC name of ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium (CID 90317907) is ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium.
What is the SMILES notation for ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium?
The canonical SMILES for ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium is CCCCCC[P+](C)(CCCCCC)CCCCCC.CCP(C)(=O)[O-].
What is the InChIKey of ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium?
The InChIKey is QAKUMSSOUIDPLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H42P.C3H9O2P/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;1-3-6(2,4)5/h5-19H2,1-4H3;3H2,1-2H3,(H,4,5)/q+1;/p-1.
What are the key properties of ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium?
ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium has a molecular weight of 408.59 g/mol, XLogP of 7.65, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(methyl)phosphinate;trihexyl(methyl)phosphanium is sourced from PubChem (CID 90317907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).