About magnesium methyl(octyl)phosphinate
magnesium methyl(octyl)phosphinate (PubChem CID 176884397) has the molecular formula C18H40MgO4P2
and a molecular weight of 406.77 g/mol. Its IUPAC name is magnesium methyl(octyl)phosphinate.
Molecular Properties
| Compound Name | magnesium methyl(octyl)phosphinate |
| PubChem CID | 176884397 |
| Molecular Formula | C18H40MgO4P2 |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | magnesium methyl(octyl)phosphinate |
| SMILES | CCCCCCCCP(C)(=O)[O-].CCCCCCCCP(C)(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C9H21O2P.Mg/c2*1-3-4-5-6-7-8-9-12(2,10)11;/h2*3-9H2,1-2H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | LMZAMIFVNATWHM-UHFFFAOYSA-L |
| XLogP | 4.85 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium methyl(octyl)phosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium methyl(octyl)phosphinate?
The IUPAC name of magnesium methyl(octyl)phosphinate (CID 176884397) is magnesium methyl(octyl)phosphinate.
What is the SMILES notation for magnesium methyl(octyl)phosphinate?
The canonical SMILES for magnesium methyl(octyl)phosphinate is CCCCCCCCP(C)(=O)[O-].CCCCCCCCP(C)(=O)[O-].[Mg+2].
What is the InChIKey of magnesium methyl(octyl)phosphinate?
The InChIKey is LMZAMIFVNATWHM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H21O2P.Mg/c2*1-3-4-5-6-7-8-9-12(2,10)11;/h2*3-9H2,1-2H3,(H,10,11);/q;;+2/p-2.
What are the key properties of magnesium methyl(octyl)phosphinate?
magnesium methyl(octyl)phosphinate has a molecular weight of 406.77 g/mol, XLogP of 4.85, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium methyl(octyl)phosphinate is sourced from PubChem (CID 176884397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).