About bis(dipentylphosphinate);nickel(2+)
bis(dipentylphosphinate);nickel(2+) (PubChem CID 22743871) has the molecular formula C20H44NiO4P2
and a molecular weight of 469.21 g/mol. Its IUPAC name is bis(dipentylphosphinate);nickel(2+).
Molecular Properties
| Compound Name | bis(dipentylphosphinate);nickel(2+) |
| PubChem CID | 22743871 |
| Molecular Formula | C20H44NiO4P2 |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | bis(dipentylphosphinate);nickel(2+) |
| SMILES | CCCCCP(=O)([O-])CCCCC.CCCCCP(=O)([O-])CCCCC.[Ni+2] |
| InChI | InChI=1S/2C10H23O2P.Ni/c2*1-3-5-7-9-13(11,12)10-8-6-4-2;/h2*3-10H2,1-2H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | LUFYIURLTGFRBS-UHFFFAOYSA-L |
| XLogP | 6.01 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dipentylphosphinate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dipentylphosphinate);nickel(2+)?
The IUPAC name of bis(dipentylphosphinate);nickel(2+) (CID 22743871) is bis(dipentylphosphinate);nickel(2+).
What is the SMILES notation for bis(dipentylphosphinate);nickel(2+)?
The canonical SMILES for bis(dipentylphosphinate);nickel(2+) is CCCCCP(=O)([O-])CCCCC.CCCCCP(=O)([O-])CCCCC.[Ni+2].
What is the InChIKey of bis(dipentylphosphinate);nickel(2+)?
The InChIKey is LUFYIURLTGFRBS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H23O2P.Ni/c2*1-3-5-7-9-13(11,12)10-8-6-4-2;/h2*3-10H2,1-2H3,(H,11,12);/q;;+2/p-2.
What are the key properties of bis(dipentylphosphinate);nickel(2+)?
bis(dipentylphosphinate);nickel(2+) has a molecular weight of 469.21 g/mol, XLogP of 6.01, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dipentylphosphinate);nickel(2+) is sourced from PubChem (CID 22743871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).