About sodium dioctylphosphinate
sodium dioctylphosphinate (PubChem CID 23691904) has the molecular formula C16H34NaO2P
and a molecular weight of 312.41 g/mol. Its IUPAC name is sodium dioctylphosphinate.
Molecular Properties
| Compound Name | sodium dioctylphosphinate |
| PubChem CID | 23691904 |
| Molecular Formula | C16H34NaO2P |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | sodium dioctylphosphinate |
| SMILES | CCCCCCCCP(=O)([O-])CCCCCCCC.[Na+] |
| InChI | InChI=1S/C16H35O2P.Na/c1-3-5-7-9-11-13-15-19(17,18)16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | AYACSFXZUWJIJK-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium dioctylphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dioctylphosphinate?
The IUPAC name of sodium dioctylphosphinate (CID 23691904) is sodium dioctylphosphinate.
What is the SMILES notation for sodium dioctylphosphinate?
The canonical SMILES for sodium dioctylphosphinate is CCCCCCCCP(=O)([O-])CCCCCCCC.[Na+].
What is the InChIKey of sodium dioctylphosphinate?
The InChIKey is AYACSFXZUWJIJK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H35O2P.Na/c1-3-5-7-9-11-13-15-19(17,18)16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,17,18);/q;+1/p-1.
What are the key properties of sodium dioctylphosphinate?
sodium dioctylphosphinate has a molecular weight of 312.41 g/mol, XLogP of 2.35, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dioctylphosphinate is sourced from PubChem (CID 23691904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).