About methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium
methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium (PubChem CID 158242345) has the molecular formula C15H34F3O3P2+
and a molecular weight of 381.38 g/mol. Its IUPAC name is methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium.
Molecular Properties
| Compound Name | methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium |
| PubChem CID | 158242345 |
| Molecular Formula | C15H34F3O3P2+ |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium |
| SMILES | CCCC[P+](C)(CCCC)CCCC.COP(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H30P.C2H4F3O3P/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-8-9(6,7)2(3,4)5/h5-13H2,1-4H3;1H3,(H,6,7)/q+1; |
| InChIKey | GFRSYCGQWHEYOF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium?
The IUPAC name of methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium (CID 158242345) is methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium.
What is the SMILES notation for methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium?
The canonical SMILES for methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium is CCCC[P+](C)(CCCC)CCCC.COP(=O)(O)C(F)(F)F.
What is the InChIKey of methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium?
The InChIKey is GFRSYCGQWHEYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30P.C2H4F3O3P/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-8-9(6,7)2(3,4)5/h5-13H2,1-4H3;1H3,(H,6,7)/q+1;.
What are the key properties of methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium?
methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium has a molecular weight of 381.38 g/mol, XLogP of 6.37, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(trifluoromethyl)phosphinic acid;tributyl(methyl)phosphanium is sourced from PubChem (CID 158242345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).