C12H24F3NO3Si — CID 15113678
trimethyl-[(2R,3R)-1,1,1-trifluoro-2-nitrononan-3-yl]oxysilane (PubChem CID 15113678) has the molecular formula C12H24F3NO3Si and a molecular weight of 315.41 g/mol. Its IUPAC name is trimethyl-[(2R,3R)-1,1,1-trifluoro-2-nitrononan-3-yl]oxysilane.
| Compound Name | trimethyl-[(2R,3R)-1,1,1-trifluoro-2-nitrononan-3-yl]oxysilane |
|---|---|
| PubChem CID | 15113678 |
| Molecular Formula | C12H24F3NO3Si |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | trimethyl-[(2R,3R)-1,1,1-trifluoro-2-nitrononan-3-yl]oxysilane |
| SMILES | CCCCCC[C@@H](O[Si](C)(C)C)[C@@H]([N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C12H24F3NO3Si/c1-5-6-7-8-9-10(19-20(2,3)4)11(16(17)18)12(13,14)15/h10-11H,5-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | HSJRQGHIANXALN-GHMZBOCLSA-N |
| XLogP | 4.38 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|