About lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate
lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate (PubChem CID 139896822) has the molecular formula C13H31LiO4P2
and a molecular weight of 320.28 g/mol. Its IUPAC name is lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate.
Molecular Properties
| Compound Name | lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate |
| PubChem CID | 139896822 |
| Molecular Formula | C13H31LiO4P2 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate |
| SMILES | CCCCP(CCC)(CCC)(CCC)OP(=O)([O-])O.[Li+] |
| InChI | InChI=1S/C13H32O4P2.Li/c1-5-9-13-19(10-6-2,11-7-3,12-8-4)17-18(14,15)16;/h5-13H2,1-4H3,(H2,14,15,16);/q;+1/p-1 |
| InChIKey | DNHYFPWHJKNNFZ-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate?
The IUPAC name of lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate (CID 139896822) is lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate.
What is the SMILES notation for lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate?
The canonical SMILES for lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate is CCCCP(CCC)(CCC)(CCC)OP(=O)([O-])O.[Li+].
What is the InChIKey of lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate?
The InChIKey is DNHYFPWHJKNNFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H32O4P2.Li/c1-5-9-13-19(10-6-2,11-7-3,12-8-4)17-18(14,15)16;/h5-13H2,1-4H3,(H2,14,15,16);/q;+1/p-1.
What are the key properties of lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate?
lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate has a molecular weight of 320.28 g/mol, XLogP of 0.97, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium [butyl(tripropyl)-λ5-phosphanyl] hydrogen phosphate is sourced from PubChem (CID 139896822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).