About decyl-dimethyl-octylazanium;dihydrogen phosphate
decyl-dimethyl-octylazanium;dihydrogen phosphate (PubChem CID 122481601) has the molecular formula C20H46NO4P
and a molecular weight of 395.57 g/mol. Its IUPAC name is decyl-dimethyl-octylazanium;dihydrogen phosphate.
Molecular Properties
| Compound Name | decyl-dimethyl-octylazanium;dihydrogen phosphate |
| PubChem CID | 122481601 |
| Molecular Formula | C20H46NO4P |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | decyl-dimethyl-octylazanium;dihydrogen phosphate |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCC.O=P([O-])(O)O |
| InChI | InChI=1S/C20H44N.H3O4P/c1-5-7-9-11-13-14-16-18-20-21(3,4)19-17-15-12-10-8-6-2;1-5(2,3)4/h5-20H2,1-4H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | IXQKXZRLXMGIDO-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze decyl-dimethyl-octylazanium;dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl-dimethyl-octylazanium;dihydrogen phosphate?
The IUPAC name of decyl-dimethyl-octylazanium;dihydrogen phosphate (CID 122481601) is decyl-dimethyl-octylazanium;dihydrogen phosphate.
What is the SMILES notation for decyl-dimethyl-octylazanium;dihydrogen phosphate?
The canonical SMILES for decyl-dimethyl-octylazanium;dihydrogen phosphate is CCCCCCCCCC[N+](C)(C)CCCCCCCC.O=P([O-])(O)O.
What is the InChIKey of decyl-dimethyl-octylazanium;dihydrogen phosphate?
The InChIKey is IXQKXZRLXMGIDO-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H44N.H3O4P/c1-5-7-9-11-13-14-16-18-20-21(3,4)19-17-15-12-10-8-6-2;1-5(2,3)4/h5-20H2,1-4H3;(H3,1,2,3,4)/q+1;/p-1.
What are the key properties of decyl-dimethyl-octylazanium;dihydrogen phosphate?
decyl-dimethyl-octylazanium;dihydrogen phosphate has a molecular weight of 395.57 g/mol, XLogP of 5.00, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl-dimethyl-octylazanium;dihydrogen phosphate is sourced from PubChem (CID 122481601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).