About dihydrogen phosphate;ethyl-dimethyl-pentylazanium
dihydrogen phosphate;ethyl-dimethyl-pentylazanium (PubChem CID 122482074) has the molecular formula C9H24NO4P
and a molecular weight of 241.27 g/mol. Its IUPAC name is dihydrogen phosphate;ethyl-dimethyl-pentylazanium.
Molecular Properties
| Compound Name | dihydrogen phosphate;ethyl-dimethyl-pentylazanium |
| PubChem CID | 122482074 |
| Molecular Formula | C9H24NO4P |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | dihydrogen phosphate;ethyl-dimethyl-pentylazanium |
| SMILES | CCCCC[N+](C)(C)CC.O=P([O-])(O)O |
| InChI | InChI=1S/C9H22N.H3O4P/c1-5-7-8-9-10(3,4)6-2;1-5(2,3)4/h5-9H2,1-4H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | SUPLORVDZBIFOM-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dihydrogen phosphate;ethyl-dimethyl-pentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydrogen phosphate;ethyl-dimethyl-pentylazanium?
The IUPAC name of dihydrogen phosphate;ethyl-dimethyl-pentylazanium (CID 122482074) is dihydrogen phosphate;ethyl-dimethyl-pentylazanium.
What is the SMILES notation for dihydrogen phosphate;ethyl-dimethyl-pentylazanium?
The canonical SMILES for dihydrogen phosphate;ethyl-dimethyl-pentylazanium is CCCCC[N+](C)(C)CC.O=P([O-])(O)O.
What is the InChIKey of dihydrogen phosphate;ethyl-dimethyl-pentylazanium?
The InChIKey is SUPLORVDZBIFOM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H22N.H3O4P/c1-5-7-8-9-10(3,4)6-2;1-5(2,3)4/h5-9H2,1-4H3;(H3,1,2,3,4)/q+1;/p-1.
What are the key properties of dihydrogen phosphate;ethyl-dimethyl-pentylazanium?
dihydrogen phosphate;ethyl-dimethyl-pentylazanium has a molecular weight of 241.27 g/mol, XLogP of 0.71, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrogen phosphate;ethyl-dimethyl-pentylazanium is sourced from PubChem (CID 122482074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).