About sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate
sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate (PubChem CID 139896839) has the molecular formula C20H45NaO3P2
and a molecular weight of 418.52 g/mol. Its IUPAC name is sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate.
Molecular Properties
| Compound Name | sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate |
| PubChem CID | 139896839 |
| Molecular Formula | C20H45NaO3P2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate |
| SMILES | CCCCP(=O)([O-])OP(CCCC)(CCCC)(CCCC)CCCC.[Na+] |
| InChI | InChI=1S/C20H46O3P2.Na/c1-6-11-16-24(21,22)23-25(17-12-7-2,18-13-8-3,19-14-9-4)20-15-10-5;/h6-20H2,1-5H3,(H,21,22);/q;+1/p-1 |
| InChIKey | CRTKBGODPQWFKJ-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate?
The IUPAC name of sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate (CID 139896839) is sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate.
What is the SMILES notation for sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate?
The canonical SMILES for sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate is CCCCP(=O)([O-])OP(CCCC)(CCCC)(CCCC)CCCC.[Na+].
What is the InChIKey of sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate?
The InChIKey is CRTKBGODPQWFKJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H46O3P2.Na/c1-6-11-16-24(21,22)23-25(17-12-7-2,18-13-8-3,19-14-9-4)20-15-10-5;/h6-20H2,1-5H3,(H,21,22);/q;+1/p-1.
What are the key properties of sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate?
sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate has a molecular weight of 418.52 g/mol, XLogP of 4.03, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium butyl-(tetrabutyl-λ5-phosphanyl)oxyphosphinate is sourced from PubChem (CID 139896839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).