About hexoxy(hexyl)phosphinate;iron(2+)
hexoxy(hexyl)phosphinate;iron(2+) (PubChem CID 87602875) has the molecular formula C24H52FeO6P2
and a molecular weight of 554.47 g/mol. Its IUPAC name is hexoxy(hexyl)phosphinate;iron(2+).
Molecular Properties
| Compound Name | hexoxy(hexyl)phosphinate;iron(2+) |
| PubChem CID | 87602875 |
| Molecular Formula | C24H52FeO6P2 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | hexoxy(hexyl)phosphinate;iron(2+) |
| SMILES | CCCCCCOP(=O)([O-])CCCCCC.CCCCCCOP(=O)([O-])CCCCCC.[Fe+2] |
| InChI | InChI=1S/2C12H27O3P.Fe/c2*1-3-5-7-9-11-15-16(13,14)12-10-8-6-4-2;/h2*3-12H2,1-2H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | VUTDHKQIMOEZAG-UHFFFAOYSA-L |
| XLogP | 7.43 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hexoxy(hexyl)phosphinate;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexoxy(hexyl)phosphinate;iron(2+)?
The IUPAC name of hexoxy(hexyl)phosphinate;iron(2+) (CID 87602875) is hexoxy(hexyl)phosphinate;iron(2+).
What is the SMILES notation for hexoxy(hexyl)phosphinate;iron(2+)?
The canonical SMILES for hexoxy(hexyl)phosphinate;iron(2+) is CCCCCCOP(=O)([O-])CCCCCC.CCCCCCOP(=O)([O-])CCCCCC.[Fe+2].
What is the InChIKey of hexoxy(hexyl)phosphinate;iron(2+)?
The InChIKey is VUTDHKQIMOEZAG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H27O3P.Fe/c2*1-3-5-7-9-11-15-16(13,14)12-10-8-6-4-2;/h2*3-12H2,1-2H3,(H,13,14);/q;;+2/p-2.
What are the key properties of hexoxy(hexyl)phosphinate;iron(2+)?
hexoxy(hexyl)phosphinate;iron(2+) has a molecular weight of 554.47 g/mol, XLogP of 7.43, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hexoxy(hexyl)phosphinate;iron(2+) is sourced from PubChem (CID 87602875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).