C19H38F6 — CID 54245833
1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;hexane;octane (PubChem CID 54245833) has the molecular formula C19H38F6 and a molecular weight of 380.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;hexane;octane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;hexane;octane |
|---|---|
| PubChem CID | 54245833 |
| Molecular Formula | C19H38F6 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;hexane;octane |
| SMILES | CC(C)(C(F)(F)F)C(F)(F)F.CCCCCC.CCCCCCCC |
| InChI | InChI=1S/C8H18.C6H14.C5H6F6/c1-3-5-7-8-6-4-2;1-3-5-6-4-2;1-3(2,4(6,7)8)5(9,10)11/h3-8H2,1-2H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | QTEVWDAKFUHYSZ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|