C10H20N2O2S — CID 97060416
2-[[(2R)-oxolan-2-yl]methoxy]ethyl N,N-dimethylcarbamimidothioate (PubChem CID 97060416) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-[[(2R)-oxolan-2-yl]methoxy]ethyl N,N-dimethylcarbamimidothioate.
| Compound Name | 2-[[(2R)-oxolan-2-yl]methoxy]ethyl N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 97060416 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[[(2R)-oxolan-2-yl]methoxy]ethyl N,N-dimethylcarbamimidothioate |
| SMILES | [H]/N=C(/SCCOC[C@H]1CCCO1)N(C)C |
| InChI | InChI=1S/C10H20N2O2S/c1-12(2)10(11)15-7-6-13-8-9-4-3-5-14-9/h9,11H,3-8H2,1-2H3/b11-10+/t9-/m1/s1 |
| InChIKey | OOGVQYLYOOUZBH-HNLKAFMCSA-N |
| XLogP | 1.41 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|