C14H31N3S — CID 149152534
3-(dimethylamino)propyl N,N-dibutylcarbamimidothioate (PubChem CID 149152534) has the molecular formula C14H31N3S and a molecular weight of 273.49 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N,N-dibutylcarbamimidothioate.
| Compound Name | 3-(dimethylamino)propyl N,N-dibutylcarbamimidothioate |
|---|---|
| PubChem CID | 149152534 |
| Molecular Formula | C14H31N3S |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 3-(dimethylamino)propyl N,N-dibutylcarbamimidothioate |
| SMILES | [H]/N=C(\SCCCN(C)C)N(CCCC)CCCC |
| InChI | InChI=1S/C14H31N3S/c1-5-7-11-17(12-8-6-2)14(15)18-13-9-10-16(3)4/h15H,5-13H2,1-4H3/b15-14- |
| InChIKey | HALLKCGDWYWSNT-PFONDFGASA-N |
| XLogP | 3.51 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|