C21H48N6 — CID 175371086
1-butyl-3,3-diethyl-1-methylguanidine;1-butyl-1,3,3-triethylguanidine (PubChem CID 175371086) has the molecular formula C21H48N6 and a molecular weight of 384.66 g/mol. Its IUPAC name is 1-butyl-3,3-diethyl-1-methylguanidine;1-butyl-1,3,3-triethylguanidine.
| Compound Name | 1-butyl-3,3-diethyl-1-methylguanidine;1-butyl-1,3,3-triethylguanidine |
|---|---|
| PubChem CID | 175371086 |
| Molecular Formula | C21H48N6 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.39 |
| IUPAC Name | 1-butyl-3,3-diethyl-1-methylguanidine;1-butyl-1,3,3-triethylguanidine |
| SMILES | [H]/N=C(\N(C)CCCC)N(CC)CC.[H]/N=C(\N(CC)CC)N(CC)CCCC |
| InChI | InChI=1S/C11H25N3.C10H23N3/c1-5-9-10-14(8-4)11(12)13(6-2)7-3;1-5-8-9-12(4)10(11)13(6-2)7-3/h12H,5-10H2,1-4H3;11H,5-9H2,1-4H3/b12-11+;11-10+ |
| InChIKey | FMYNTSGGHOVXJP-CXJFYUDPSA-N |
| XLogP | 4.38 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|