About CID 22121637
CID 22121637 (PubChem CID 22121637) has the molecular formula C17H35N2Se
and a molecular weight of 346.44 g/mol.
Molecular Properties
| Compound Name | CID 22121637 |
| PubChem CID | 22121637 |
| Molecular Formula | C17H35N2Se |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\[Se])N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C17H35N2Se/c1-3-5-7-9-11-13-15-19(17(18)20)16-14-12-10-8-6-4-2/h18H,3-16H2,1-2H3/b18-17- |
| InChIKey | SFQDZSIHHLCORD-ZCXUNETKSA-N |
| XLogP | 5.11 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 22121637 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22121637?
The IUPAC name of CID 22121637 (CID 22121637) is not available.
What is the SMILES notation for CID 22121637?
The canonical SMILES for CID 22121637 is [H]/N=C(\[Se])N(CCCCCCCC)CCCCCCCC.
What is the InChIKey of CID 22121637?
The InChIKey is SFQDZSIHHLCORD-ZCXUNETKSA-N. The full InChI is InChI=1S/C17H35N2Se/c1-3-5-7-9-11-13-15-19(17(18)20)16-14-12-10-8-6-4-2/h18H,3-16H2,1-2H3/b18-17-.
What are the key properties of CID 22121637?
CID 22121637 has a molecular weight of 346.44 g/mol, XLogP of 5.11, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22121637 is sourced from PubChem (CID 22121637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).