C14H32ClN5 — CID 176518115
2-carbamimidoyl-1,1-dihexylguanidine;hydrochloride (PubChem CID 176518115) has the molecular formula C14H32ClN5 and a molecular weight of 305.90 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dihexylguanidine;hydrochloride.
| Compound Name | 2-carbamimidoyl-1,1-dihexylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176518115 |
| Molecular Formula | C14H32ClN5 |
| Molecular Weight | 305.90 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 2-carbamimidoyl-1,1-dihexylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N=C(N)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C14H31N5.ClH/c1-3-5-7-9-11-19(12-10-8-6-4-2)14(17)18-13(15)16;/h3-12H2,1-2H3,(H5,15,16,17,18);1H |
| InChIKey | BNMIXGCZRNUFBJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|