C12H28ClN5 — CID 176530565
2-carbamimidoyl-1,1-dipentylguanidine;hydrochloride (PubChem CID 176530565) has the molecular formula C12H28ClN5 and a molecular weight of 277.84 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dipentylguanidine;hydrochloride.
| Compound Name | 2-carbamimidoyl-1,1-dipentylguanidine;hydrochloride |
|---|---|
| PubChem CID | 176530565 |
| Molecular Formula | C12H28ClN5 |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-carbamimidoyl-1,1-dipentylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N=C(N)N(CCCCC)CCCCC |
| InChI | InChI=1S/C12H27N5.ClH/c1-3-5-7-9-17(10-8-6-4-2)12(15)16-11(13)14;/h3-10H2,1-2H3,(H5,13,14,15,16);1H |
| InChIKey | MNFVOBDZWLQHFW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|