C10H23N5 — CID 176525602
1-butyl-1-tert-butyl-2-carbamimidoylguanidine (PubChem CID 176525602) has the molecular formula C10H23N5 and a molecular weight of 213.33 g/mol. Its IUPAC name is 1-butyl-1-tert-butyl-2-carbamimidoylguanidine.
| Compound Name | 1-butyl-1-tert-butyl-2-carbamimidoylguanidine |
|---|---|
| PubChem CID | 176525602 |
| Molecular Formula | C10H23N5 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.20 |
| IUPAC Name | 1-butyl-1-tert-butyl-2-carbamimidoylguanidine |
| SMILES | [H]/N=C(\N)N=C(N)N(CCCC)C(C)(C)C |
| InChI | InChI=1S/C10H23N5/c1-5-6-7-15(10(2,3)4)9(13)14-8(11)12/h5-7H2,1-4H3,(H5,11,12,13,14) |
| InChIKey | KJAJVTVPNNVRIT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|