About 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide
2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide (PubChem CID 53347552) has the molecular formula C10H14BrN2O2S2-
and a molecular weight of 338.27 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide |
| PubChem CID | 53347552 |
| Molecular Formula | C10H14BrN2O2S2- |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide |
| SMILES | [Br-].[H]/N=C(\N)SCCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H14N2O2S2.BrH/c1-8-2-4-9(5-3-8)16(13,14)7-6-15-10(11)12;/h2-5H,6-7H2,1H3,(H3,11,12);1H/p-1 |
| InChIKey | NNYJPYPQEDERLZ-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide?
The IUPAC name of 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide (CID 53347552) is 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide.
What is the SMILES notation for 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide?
The canonical SMILES for 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide is [Br-].[H]/N=C(\N)SCCS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide?
The InChIKey is NNYJPYPQEDERLZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14N2O2S2.BrH/c1-8-2-4-9(5-3-8)16(13,14)7-6-15-10(11)12;/h2-5H,6-7H2,1H3,(H3,11,12);1H/p-1.
What are the key properties of 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide?
2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide has a molecular weight of 338.27 g/mol, XLogP of -1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfonylethyl carbamimidothioate bromide is sourced from PubChem (CID 53347552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).