C11H24N4O2S2 — CID 173442898
acetic acid;6-(methylcarbamothioylamino)hexyl carbamimidothioate (PubChem CID 173442898) has the molecular formula C11H24N4O2S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is acetic acid;6-(methylcarbamothioylamino)hexyl carbamimidothioate.
| Compound Name | acetic acid;6-(methylcarbamothioylamino)hexyl carbamimidothioate |
|---|---|
| PubChem CID | 173442898 |
| Molecular Formula | C11H24N4O2S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | acetic acid;6-(methylcarbamothioylamino)hexyl carbamimidothioate |
| SMILES | CC(=O)O.[H]/N=C(\N)SCCCCCCNC(=S)NC |
| InChI | InChI=1S/C9H20N4S2.C2H4O2/c1-12-9(14)13-6-4-2-3-5-7-15-8(10)11;1-2(3)4/h2-7H2,1H3,(H3,10,11)(H2,12,13,14);1H3,(H,3,4) |
| InChIKey | MIBJTIVXZDPFDY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|