About (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide
(3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide (PubChem CID 3056803) has the molecular formula C10H14BrN3OS
and a molecular weight of 304.21 g/mol. Its IUPAC name is (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide |
| PubChem CID | 3056803 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H13N3OS.BrH/c11-10(12)15-7-6-9(14)13-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H3,11,12)(H,13,14);1H |
| InChIKey | NIUMTQFFKPBTSQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide?
The IUPAC name of (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide (CID 3056803) is (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide.
What is the SMILES notation for (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide?
The canonical SMILES for (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)SCCC(=O)Nc1ccccc1.
What is the InChIKey of (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide?
The InChIKey is NIUMTQFFKPBTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS.BrH/c11-10(12)15-7-6-9(14)13-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H3,11,12)(H,13,14);1H.
What are the key properties of (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide?
(3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide has a molecular weight of 304.21 g/mol, XLogP of 2.22, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-anilino-3-oxopropyl) carbamimidothioate;hydrobromide is sourced from PubChem (CID 3056803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).