C20H20N4S3 — CID 59497830
[5-(carbamimidoylsulfanylmethyl)-3,4-diphenylthiophen-2-yl]methyl carbamimidothioate (PubChem CID 59497830) has the molecular formula C20H20N4S3 and a molecular weight of 412.61 g/mol. Its IUPAC name is [5-(carbamimidoylsulfanylmethyl)-3,4-diphenylthiophen-2-yl]methyl carbamimidothioate.
| Compound Name | [5-(carbamimidoylsulfanylmethyl)-3,4-diphenylthiophen-2-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 59497830 |
| Molecular Formula | C20H20N4S3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [5-(carbamimidoylsulfanylmethyl)-3,4-diphenylthiophen-2-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1sc(CS/C(N)=N/[H])c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4S3/c21-19(22)25-11-15-17(13-7-3-1-4-8-13)18(14-9-5-2-6-10-14)16(27-15)12-26-20(23)24/h1-10H,11-12H2,(H3,21,22)(H3,23,24) |
| InChIKey | LIUIDQKAOHSGCV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|