C9H19O5PS — CID 118263162
2-dimethoxyphosphorylsulfanylethyl 2,2-dimethylpropanoate (PubChem CID 118263162) has the molecular formula C9H19O5PS and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-dimethoxyphosphorylsulfanylethyl 2,2-dimethylpropanoate.
| Compound Name | 2-dimethoxyphosphorylsulfanylethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118263162 |
| Molecular Formula | C9H19O5PS |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-dimethoxyphosphorylsulfanylethyl 2,2-dimethylpropanoate |
| SMILES | COP(=O)(OC)SCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H19O5PS/c1-9(2,3)8(10)14-6-7-16-15(11,12-4)13-5/h6-7H2,1-5H3 |
| InChIKey | DXPYJOYZGAVUOV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|