C8H20NO5PS — CID 170089207
2-amino-1-(2-dimethoxyphosphorylsulfanylethoxy)-2-methylpropan-1-ol (PubChem CID 170089207) has the molecular formula C8H20NO5PS and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-amino-1-(2-dimethoxyphosphorylsulfanylethoxy)-2-methylpropan-1-ol.
| Compound Name | 2-amino-1-(2-dimethoxyphosphorylsulfanylethoxy)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 170089207 |
| Molecular Formula | C8H20NO5PS |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-amino-1-(2-dimethoxyphosphorylsulfanylethoxy)-2-methylpropan-1-ol |
| SMILES | COP(=O)(OC)SCCOC(O)C(C)(C)N |
| InChI | InChI=1S/C8H20NO5PS/c1-8(2,9)7(10)14-5-6-16-15(11,12-3)13-4/h7,10H,5-6,9H2,1-4H3 |
| InChIKey | DWHOTPRDSPZTRQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|