C16H35O8PS — CID 146185573
1-[4-[2-hydroxyethoxy-(3-hydroxy-1-methoxybutan-2-yl)oxyphosphoryl]sulfanylbutoxy]-2,2-dimethylpropan-1-ol (PubChem CID 146185573) has the molecular formula C16H35O8PS and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[4-[2-hydroxyethoxy-(3-hydroxy-1-methoxybutan-2-yl)oxyphosphoryl]sulfanylbutoxy]-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[4-[2-hydroxyethoxy-(3-hydroxy-1-methoxybutan-2-yl)oxyphosphoryl]sulfanylbutoxy]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 146185573 |
| Molecular Formula | C16H35O8PS |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[4-[2-hydroxyethoxy-(3-hydroxy-1-methoxybutan-2-yl)oxyphosphoryl]sulfanylbutoxy]-2,2-dimethylpropan-1-ol |
| SMILES | COCC(OP(=O)(OCCO)SCCCCOC(O)C(C)(C)C)C(C)O |
| InChI | InChI=1S/C16H35O8PS/c1-13(18)14(12-21-5)24-25(20,23-10-8-17)26-11-7-6-9-22-15(19)16(2,3)4/h13-15,17-19H,6-12H2,1-5H3 |
| InChIKey | VJEARRGSPJYPFH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|