C14H30NO5PS — CID 134232882
2-[3-methylbutan-2-yloxy(propan-2-yloxy)phosphoryl]sulfanylethyl 2-amino-2-methylpropanoate (PubChem CID 134232882) has the molecular formula C14H30NO5PS and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[3-methylbutan-2-yloxy(propan-2-yloxy)phosphoryl]sulfanylethyl 2-amino-2-methylpropanoate.
| Compound Name | 2-[3-methylbutan-2-yloxy(propan-2-yloxy)phosphoryl]sulfanylethyl 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 134232882 |
| Molecular Formula | C14H30NO5PS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[3-methylbutan-2-yloxy(propan-2-yloxy)phosphoryl]sulfanylethyl 2-amino-2-methylpropanoate |
| SMILES | CC(C)OP(=O)(OC(C)C(C)C)SCCOC(=O)C(C)(C)N |
| InChI | InChI=1S/C14H30NO5PS/c1-10(2)12(5)20-21(17,19-11(3)4)22-9-8-18-13(16)14(6,7)15/h10-12H,8-9,15H2,1-7H3 |
| InChIKey | BAANKOUWRILMCS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|