C8H16N2O3S2 — CID 145262173
2-(methyldisulfanyl)ethyl N-(2-methylpropanoylamino)carbamate (PubChem CID 145262173) has the molecular formula C8H16N2O3S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(methyldisulfanyl)ethyl N-(2-methylpropanoylamino)carbamate.
| Compound Name | 2-(methyldisulfanyl)ethyl N-(2-methylpropanoylamino)carbamate |
|---|---|
| PubChem CID | 145262173 |
| Molecular Formula | C8H16N2O3S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(methyldisulfanyl)ethyl N-(2-methylpropanoylamino)carbamate |
| SMILES | CSSCCOC(=O)NNC(=O)C(C)C |
| InChI | InChI=1S/C8H16N2O3S2/c1-6(2)7(11)9-10-8(12)13-4-5-15-14-3/h6H,4-5H2,1-3H3,(H,9,11)(H,10,12) |
| InChIKey | YFPYBOCOSTYNBW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|