C15H33N3OS2 — CID 175615257
(2R)-2-amino-N-[5-(methyldisulfanyl)pentyl]-6-(propan-2-ylamino)hexanamide (PubChem CID 175615257) has the molecular formula C15H33N3OS2 and a molecular weight of 335.58 g/mol. Its IUPAC name is (2R)-2-amino-N-[5-(methyldisulfanyl)pentyl]-6-(propan-2-ylamino)hexanamide.
| Compound Name | (2R)-2-amino-N-[5-(methyldisulfanyl)pentyl]-6-(propan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 175615257 |
| Molecular Formula | C15H33N3OS2 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (2R)-2-amino-N-[5-(methyldisulfanyl)pentyl]-6-(propan-2-ylamino)hexanamide |
| SMILES | CSSCCCCCNC(=O)[C@H](N)CCCCNC(C)C |
| InChI | InChI=1S/C15H33N3OS2/c1-13(2)17-10-7-5-9-14(16)15(19)18-11-6-4-8-12-21-20-3/h13-14,17H,4-12,16H2,1-3H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | LJIIULKQYXFGQH-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|