C7H12N2O5S2 — CID 59197785
4-[2-[2-(disulfanyl)ethoxycarbonyl]hydrazinyl]-4-oxobutanoic acid (PubChem CID 59197785) has the molecular formula C7H12N2O5S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-[2-[2-(disulfanyl)ethoxycarbonyl]hydrazinyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-(disulfanyl)ethoxycarbonyl]hydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59197785 |
| Molecular Formula | C7H12N2O5S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-[2-[2-(disulfanyl)ethoxycarbonyl]hydrazinyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NNC(=O)OCCSS |
| InChI | InChI=1S/C7H12N2O5S2/c10-5(1-2-6(11)12)8-9-7(13)14-3-4-16-15/h15H,1-4H2,(H,8,10)(H,9,13)(H,11,12) |
| InChIKey | COBJJZNPRLTHLU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|