C12H18N2O8 — CID 20648247
4-[2-[2-(3-carboxypropanoylamino)acetyl]oxyethylamino]-4-oxobutanoic acid (PubChem CID 20648247) has the molecular formula C12H18N2O8 and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-[2-[2-(3-carboxypropanoylamino)acetyl]oxyethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-(3-carboxypropanoylamino)acetyl]oxyethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20648247 |
| Molecular Formula | C12H18N2O8 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-[2-[2-(3-carboxypropanoylamino)acetyl]oxyethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCOC(=O)CNC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H18N2O8/c15-8(1-3-10(17)18)13-5-6-22-12(21)7-14-9(16)2-4-11(19)20/h1-7H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | KLMGXHYSAKDELJ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|