C18H36N2O7Si2 — CID 170942066
4-[3-[[3-(3-carboxypropanoylamino)propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobutanoic acid (PubChem CID 170942066) has the molecular formula C18H36N2O7Si2 and a molecular weight of 448.67 g/mol. Its IUPAC name is 4-[3-[[3-(3-carboxypropanoylamino)propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[[3-(3-carboxypropanoylamino)propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170942066 |
| Molecular Formula | C18H36N2O7Si2 |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-[3-[[3-(3-carboxypropanoylamino)propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobutanoic acid |
| SMILES | C[Si](C)(CCCNC(=O)CCC(=O)O)O[Si](C)(C)CCCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C18H36N2O7Si2/c1-28(2,13-5-11-19-15(21)7-9-17(23)24)27-29(3,4)14-6-12-20-16(22)8-10-18(25)26/h5-14H2,1-4H3,(H,19,21)(H,20,22)(H,23,24)(H,25,26) |
| InChIKey | JPKFXVBTEHGGEC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|