C16H38N2O4Si3 — CID 153418128
N-[3-[[[3-acetamidopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]acetamide (PubChem CID 153418128) has the molecular formula C16H38N2O4Si3 and a molecular weight of 406.75 g/mol. Its IUPAC name is N-[3-[[[3-acetamidopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]acetamide.
| Compound Name | N-[3-[[[3-acetamidopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]acetamide |
|---|---|
| PubChem CID | 153418128 |
| Molecular Formula | C16H38N2O4Si3 |
| Molecular Weight | 406.75 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[3-[[[3-acetamidopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]acetamide |
| SMILES | CC(=O)NCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCNC(C)=O |
| InChI | InChI=1S/C16H38N2O4Si3/c1-15(19)17-11-9-13-23(3,4)21-25(7,8)22-24(5,6)14-10-12-18-16(2)20/h9-14H2,1-8H3,(H,17,19)(H,18,20) |
| InChIKey | NWOORSZMZYQUGR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|